CymitQuimica logo

CAS 780756-54-9

:

4-(pyrrolidin-1-ylmethyl)piperidine dihydrochloride

Description:
4-(Pyrrolidin-1-ylmethyl)piperidine dihydrochloride is a chemical compound characterized by its dual cyclic structure, which includes a piperidine ring and a pyrrolidine moiety. This compound is typically encountered as a dihydrochloride salt, enhancing its solubility in aqueous environments, which is advantageous for various applications, particularly in pharmaceutical contexts. The presence of both nitrogen-containing rings contributes to its potential biological activity, making it of interest in medicinal chemistry for the development of therapeutic agents. Its molecular structure suggests that it may interact with neurotransmitter systems, possibly influencing cognitive or behavioral functions. The compound's properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. As with many nitrogenous compounds, it may exhibit basicity, allowing it to form salts with acids. Safety and handling precautions are essential due to its potential biological effects, and it should be managed in accordance with relevant safety guidelines.
Formula:C10H21ClN2
InChI:InChI=1/C10H20N2.2ClH/c1-2-8-12(7-1)9-10-3-5-11-6-4-10;;/h10-11H,1-9H2;2*1H
InChI key:NOSKZLBNQLEUKE-UHFFFAOYSA-N
SMILES:C1CCN(C1)CC1CCNCC1.Cl.Cl
Synonyms:
  • Piperidine, 4-(1-Pyrrolidinylmethyl)-, Hydrochloride (1:2)
  • 4-(Pyrrolidin-1-ylmethyl)piperidine dihydrochloride
  • 4-(1-PyrrolidinylMethyl)-piperidine 2HCl
  • 4-(1-Pyrrolidinylmethyl)piperidine dihydrochloride
Found 4 products.