CAS 781-43-1
:9,10-Dimethylanthracene
Description:
9,10-Dimethylanthracene is an organic compound belonging to the anthracene family, characterized by its polycyclic aromatic structure. It features two methyl groups attached to the anthracene backbone at the 9 and 10 positions, which influences its physical and chemical properties. This compound typically appears as a crystalline solid with a high melting point and exhibits strong fluorescence, making it of interest in various applications, including organic electronics and photonics. 9,10-Dimethylanthracene is relatively insoluble in water but soluble in organic solvents such as benzene and toluene. Its chemical stability allows it to undergo various reactions, including electrophilic substitution, which is common for aromatic compounds. Additionally, it has been studied for its potential role in the development of organic semiconductors and as a fluorescent probe in biochemical applications. However, like many polycyclic aromatic hydrocarbons, it may pose environmental and health risks, necessitating careful handling and disposal.
Formula:C16H14
InChI:InChI=1S/C16H14/c1-11-13-7-3-5-9-15(13)12(2)16-10-6-4-8-14(11)16/h3-10H,1-2H3
InChI key:InChIKey=JTGMTYWYUZDRBK-UHFFFAOYSA-N
SMILES:CC=1C2=C(C(C)=C3C1C=CC=C3)C=CC=C2
Synonyms:- 9,10-Dimethylanthracen
- 9,10-Dimetilantraceno
- 9,1O-dimethylanthracene
- 9-10-Dimethylanthracene Crystalline
- Anthracene, 9,10-dimethyl-
- Nsc 4220
- 9,10-Dimethylanthracene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
9,10-Dimethylanthracene, 97%
CAS:9,10-Dimethylanthracene is used as an antioxidant-photosensitizer dual-loaded polymeric micelles with controllable production of reactive oxygen species. It is also used as chemical rate constant actinometer in singlet molecular oxygen reactions. This Thermo Scientific Chemicals brand product was oFormula:C16H14Purity:97%Color and Shape:Yellow, Crystals or powder or crystalline powderMolecular weight:206.299,10-Dimethylanthracene
CAS:9,10-DimethylanthraceneFormula:C16H14Purity:95%Color and Shape:Solid-PowderMolecular weight:206.289,10-Dimethylanthracene
CAS:9,10-Dimethylanthracene has antibacterial activity against Escherichia coli and is widely used in biochemical experiments and drug synthesis research.Formula:C16H14Purity:95.20%Color and Shape:SolidMolecular weight:206.289,10-Dimethylanthracene
CAS:Formula:C16H14Purity:>98.0%(GC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:206.29






