CymitQuimica logo

CAS 78238-13-8

:

Benzoic acid, 3-methoxy-5-nitro-, methyl ester

Description:
Benzoic acid, 3-methoxy-5-nitro-, methyl ester, identified by the CAS number 78238-13-8, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety modified with both methoxy and nitro functional groups. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. The presence of the methoxy group (-OCH3) enhances its solubility in organic solvents, while the nitro group (-NO2) can influence its reactivity and polarity. Benzoic acid derivatives are known for their applications in various fields, including pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The specific arrangement of substituents on the benzene ring affects the compound's chemical properties, such as acidity, reactivity, and potential biological activity. Additionally, the methyl ester form indicates that the carboxylic acid group has been esterified, which can alter the compound's behavior in chemical reactions and its interactions with biological systems.
Formula:C9H9NO5
InChI:InChI=1S/C9H9NO5/c1-14-8-4-6(9(11)15-2)3-7(5-8)10(12)13/h3-5H,1-2H3
InChI key:InChIKey=OSTVXCVLGHROLX-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(N(=O)=O)=CC(OC)=C1
Synonyms:
  • 3-Methoxy-5-nitrobenzoic acid methyl ester
  • 3-Methoxy-5-nitrobenzoicacid methyl ester
  • Methyl 3-methoxy-5-nitrobenzoate
  • Benzoic acid, 3-methoxy-5-nitro-, methyl ester
Found 5 products.