CymitQuimica logo

CAS 78316-09-3

:

methyl 7aH-imidazo[4,5-b]pyridine-7-carboxylate

Description:
Methyl 7aH-imidazo[4,5-b]pyridine-7-carboxylate is a heterocyclic organic compound characterized by its imidazo-pyridine structure, which incorporates both nitrogen and carbon atoms in its ring system. This compound features a carboxylate functional group, which contributes to its reactivity and solubility properties. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of the methyl ester group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. Methyl 7aH-imidazo[4,5-b]pyridine-7-carboxylate may also participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions, due to the electron-rich nature of the imidazole ring. Its structural characteristics suggest potential applications in the synthesis of more complex molecules or as a scaffold for developing new therapeutic agents. As with many heterocycles, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C8H7N3O2
InChI:InChI=1/C8H7N3O2/c1-13-8(12)5-2-3-9-7-6(5)10-4-11-7/h2-4,6H,1H3
InChI key:IEVPXSBGABKEOL-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC=NC2=NC=NC12
Found 3 products.