CymitQuimica logo

CAS 78317-83-6

:

Isoquinoline, 1,2,3,4-tetrahydro-2-(4-methoxyphenyl)-

Description:
Isoquinoline, 1,2,3,4-tetrahydro-2-(4-methoxyphenyl)-, identified by CAS number 78317-83-6, is a chemical compound that belongs to the isoquinoline family, characterized by a bicyclic structure containing a fused benzene and pyridine ring. This specific compound features a tetrahydroisoquinoline core, indicating that it has undergone partial hydrogenation, resulting in a saturated ring structure. The presence of a 4-methoxyphenyl group enhances its molecular complexity and may influence its chemical reactivity and biological activity. Isoquinolines are known for their diverse pharmacological properties, including potential applications in medicinal chemistry. The methoxy group can enhance lipophilicity and may affect the compound's interaction with biological targets. Additionally, the compound's structure suggests potential for various substitution reactions, making it a candidate for further synthetic modifications. Overall, this compound exemplifies the rich chemistry associated with isoquinoline derivatives, which are of interest in both academic research and pharmaceutical development.
Formula:C16H17NO
InChI:InChI=1S/C16H17NO/c1-18-16-8-6-15(7-9-16)17-11-10-13-4-2-3-5-14(13)12-17/h2-9H,10-12H2,1H3
InChI key:GNVXOIRECQQWBJ-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)N2CCC3=CC=CC=C3C2
Found 4 products.