CAS 783355-60-2: Abexinostat
Description:Abexinostat is a small molecule inhibitor primarily known for its role as a histone deacetylase (HDAC) inhibitor, which is significant in the field of cancer therapy. It is characterized by its ability to modulate gene expression by altering the acetylation status of histones, thereby influencing cellular processes such as proliferation, differentiation, and apoptosis. Abexinostat has been investigated for its potential efficacy in treating various malignancies, including hematological cancers and solid tumors. The compound is typically administered orally and has shown promise in preclinical and clinical studies, often in combination with other therapeutic agents to enhance anti-tumor activity. Its chemical structure includes a core that allows for interaction with the HDAC enzyme, leading to the inhibition of its activity. As with many HDAC inhibitors, the therapeutic application of Abexinostat is accompanied by a profile of potential side effects, which necessitates careful monitoring during treatment. Overall, Abexinostat represents a valuable addition to the arsenal of targeted cancer therapies.
Formula:C21H23N3O5
InChI:InChI=1S/C21H23N3O5/c1-24(2)13-17-16-5-3-4-6-18(16)29-19(17)21(26)22-11-12-28-15-9-7-14(8-10-15)20(25)23-27/h3-10,27H,11-13H2,1-2H3,(H,22,26)(H,23,25)
InChI key:InChIKey=MAUCONCHVWBMHK-UHFFFAOYSA-N
SMILES:O=C(NO)C1=CC=C(OCCNC(=O)C=2OC=3C=CC=CC3C2CN(C)C)C=C1
- Synonyms:
- 2-Benzofurancarboxamide, 3-[(dimethylamino)methyl]-N-[2-[4-[(hydroxyamino)carbonyl]phenoxy]ethyl]-
- 3-[(Dimethylamino)methyl]-N-[2-[4-[(hydroxyamino)carbonyl]phenoxy]ethyl]-2-benzofurancarboxamide
- Abexinostat
- Brd K12867552
- Cra 024781
- Cra 24781
- Pci 24781
- Thm-I 94
