CAS 78385-26-9: 3-(Bromomethyl)-3-methyloxetane
Description:3-(Bromomethyl)-3-methyloxetane is a chemical compound characterized by its oxetane ring structure, which is a four-membered cyclic ether. The presence of a bromomethyl group at the 3-position and a methyl group at the same position contributes to its unique reactivity and properties. This compound is typically a colorless to pale yellow liquid and is known for its potential applications in organic synthesis, particularly in the formation of more complex molecules through nucleophilic substitution reactions. The bromomethyl group serves as a good leaving group, making it useful in various chemical transformations. Additionally, the oxetane ring can undergo ring-opening reactions under certain conditions, further enhancing its utility in synthetic chemistry. Due to the presence of bromine, it may exhibit moderate toxicity and should be handled with appropriate safety precautions. Overall, 3-(Bromomethyl)-3-methyloxetane is a versatile intermediate in the field of organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C5H9BrO
InChI:InChI=1S/C5H9BrO/c1-5(2-6)3-7-4-5/h2-4H2,1H3
InChI key:InChIKey=MGBZKWOJRYGRTO-UHFFFAOYSA-N
SMILES:BrCC1(C)COC1
- Synonyms:
- Oxetane, 2-(bromomethyl)-3-methyl-
- Oxetane, 3-bromomethyl-3-methyl-
- 3-Bromomethyl-3-Methyloxetane
- 3-(Bromomethyl)-3-methyloxetane

3-(Bromomethyl)-3-methyloxetane
Ref: IN-DA005BEK
1g | 30.00 € | ||
5g | 51.00 € | ||
10g | 75.00 € | ||
250mg | To inquire |

3-(Bromomethyl)-3-methyloxetane
Ref: 54-OR309052
1g | 38.00 € | ||
5g | 108.00 € |

3-Bromomethyl-3-methyloxetane
Ref: 10-F033204
1g | 12.00 € | ||
5g | 31.00 € | ||
10g | 56.00 € | ||
25g | 123.00 € | ||
50g | 238.00 € |

3-(Bromomethyl)-3-methyloxetane
Ref: 3B-B5424
1g | 88.00 € |

3-Bromomethyl-3-methyloxetane
Ref: 3D-FB46286
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
25g | Discontinued | Request information |