CymitQuimica logo

CAS 78385-84-9

:

Bicyclo[2.2.2]octane-1-carboxylic acid, 4-fluoro-

Description:
Bicyclo[2.2.2]octane-1-carboxylic acid, 4-fluoro- is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a central bicyclo[2.2.2]octane framework with a carboxylic acid functional group and a fluorine substituent at the fourth position. This compound is typically a colorless to pale yellow solid at room temperature and is soluble in organic solvents. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The fluorine atom can influence the compound's reactivity and polarity, potentially enhancing its biological activity or altering its interaction with other molecules. Bicyclo[2.2.2]octane derivatives are of interest in medicinal chemistry and materials science due to their unique structural properties and potential applications in drug development and polymer synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H13FO2
InChI:InChI=1S/C9H13FO2/c10-9-4-1-8(2-5-9,3-6-9)7(11)12/h1-6H2,(H,11,12)
InChI key:CCOTVPAWNHYJSJ-UHFFFAOYSA-N
SMILES:C1CC2(CCC1(CC2)C(=O)O)F
Synonyms:
  • 4-Fluorobicyclo[2.2.2]Octane-1-Carboxylic Acid
Found 4 products.