CymitQuimica logo

CAS 784-77-0

:

3-Nitro-4-(trifluoromethoxyl)benzoic acid

Description:
3-Nitro-4-(trifluoromethoxyl)benzoic acid is an aromatic compound characterized by the presence of a nitro group and a trifluoromethoxy group attached to a benzoic acid framework. The molecular structure features a benzene ring substituted at the 3-position with a nitro group (-NO2) and at the 4-position with a trifluoromethoxy group (-O-CF3). This compound is typically a solid at room temperature and is known for its relatively high stability due to the resonance effects of the aromatic system. The trifluoromethoxy group enhances its lipophilicity and can influence its reactivity and solubility in organic solvents. As a benzoic acid derivative, it exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and nucleophilic substitutions. Additionally, the presence of both electron-withdrawing groups (the nitro and trifluoromethoxy groups) can significantly affect its electronic properties, making it useful in various applications, including pharmaceuticals and agrochemicals. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H4F3NO5
InChI:InChI=1S/C8H4F3NO5/c9-8(10,11)17-6-2-1-4(7(13)14)3-5(6)12(15)16/h1-3H,(H,13,14)
InChI key:GDBCQTKUSLDFRP-UHFFFAOYSA-N
SMILES:c1cc(c(cc1C(=O)O)N(=O)=O)OC(F)(F)F
Synonyms:
  • Benzoic Acid, 3-Nitro-4-(Trifluoromethoxy)-
Found 4 products.