CymitQuimica logo

CAS 78522-71-1

:

1,1,2,2,3,3,4,4-octafluorobutane-1,4-diyl difluorosulfate

Description:
1,1,2,2,3,3,4,4-Octafluorobutane-1,4-diyl difluorosulfate is a fluorinated organic compound characterized by its unique structure, which includes a butane backbone fully substituted with fluorine atoms and a difluorosulfate functional group. This compound is notable for its high thermal and chemical stability, which is typical of perfluorinated compounds. Its fluorinated nature imparts low surface tension and high hydrophobicity, making it useful in various applications, including as a potential intermediate in the synthesis of specialty chemicals. The presence of the difluorosulfate group suggests reactivity that could be exploited in further chemical transformations. Additionally, the compound's properties may include low volatility and high density, which are common in fluorinated substances. However, due to the environmental concerns associated with fluorinated compounds, particularly regarding their persistence and potential effects on human health and ecosystems, handling and disposal must be approached with caution. Overall, 1,1,2,2,3,3,4,4-octafluorobutane-1,4-diyl difluorosulfate represents a complex and specialized chemical with distinct characteristics.
Formula:C4F10O6S2
InChI:InChI=1/C4F10O6S2/c5-1(6,3(9,10)19-21(13,15)16)2(7,8)4(11,12)20-22(14,17)18
SMILES:C(C(C(F)(F)OS(=O)(=O)F)(F)F)(C(F)(F)OS(=O)(=O)F)(F)F
Found 1 products.