CymitQuimica logo

CAS 78573-85-0

:

1-Bromo-7-phenylheptane

Description:
1-Bromo-7-phenylheptane is an organic compound characterized by its structure, which features a bromine atom attached to a heptane chain that has a phenyl group at the seventh carbon position. This compound belongs to the class of alkyl halides, specifically bromoalkanes, and exhibits properties typical of such compounds, including moderate polarity due to the presence of the bromine atom. The phenyl group contributes to the compound's hydrophobic characteristics, influencing its solubility in organic solvents while rendering it less soluble in water. 1-Bromo-7-phenylheptane can participate in various chemical reactions, such as nucleophilic substitutions and eliminations, making it useful in organic synthesis. Its molecular structure allows for potential applications in the development of pharmaceuticals, agrochemicals, and other organic materials. Additionally, the presence of the bromine atom can facilitate further functionalization, enhancing its utility in synthetic chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks typical of halogenated organic substances.
Formula:C13H19Br
InChI:InChI=1/C13H19Br/c14-12-8-3-1-2-5-9-13-10-6-4-7-11-13/h4,6-7,10-11H,1-3,5,8-9,12H2
InChI key:ASLQYSAHLPRDAY-UHFFFAOYSA-N
SMILES:C(CCCc1ccccc1)CCCBr
Synonyms:
  • (7-Bromheptyl)benzol
  • (7-Bromoheptyl)benzene
  • Benzene, (7-bromoheptyl)-
Found 4 products.