CAS 78574-94-4: Cycloastragenol
Description:Cycloastragenol is a natural compound derived from the root of Astragalus membranaceus, a plant commonly used in traditional medicine. It is classified as a triterpenoid saponin and is known for its potential health benefits, particularly in promoting cellular health and longevity. Cycloastragenol is recognized for its ability to activate telomerase, an enzyme that helps maintain telomere length, which is associated with cellular aging. The compound is typically a white to off-white powder and is soluble in organic solvents but has limited solubility in water. Its molecular structure features a complex arrangement of carbon, hydrogen, and oxygen atoms, contributing to its biological activity. Research into cycloastragenol has suggested various pharmacological effects, including antioxidant properties and immune system support. However, further studies are needed to fully understand its mechanisms and therapeutic potential. As with any supplement, it is essential to consult healthcare professionals before use, especially considering individual health conditions and potential interactions with other medications.
Formula:C30H50O5
InChI:InChI=1S/C30H50O5/c1-24(2)20(33)8-11-30-16-29(30)13-12-26(5)23(28(7)10-9-21(35-28)25(3,4)34)18(32)15-27(26,6)19(29)14-17(31)22(24)30/h17-23,31-34H,8-16H2,1-7H3/t17-,18-,19-,20-,21-,22-,23-,26+,27-,28+,29-,30+/m0/s1
InChI key:InChIKey=WENNXORDXYGDTP-UOUCMYEWSA-N
SMILES:OC1CC2C3(C)CC(O)C(C4(OC(CC4)C(O)(C)C)C)C3(C)CCC52CC65CCC(O)C(C)(C)C16
- Synonyms:
- Cyclosiversigenin
- Cycloastragenol
- (3β,6α,16β,20R,24S)-20,24-Epoxy-9,19-cyclolanostane-3,6,16,25-tetrol
- Astramembrangenin
- 9,19-Cyclolanostane-3,6,16,25-tetrol, 20,24-epoxy-, (3β,6α,16β,20R,24S)-