CymitQuimica logo

CAS 78603-23-3

:

Z-D-Lys(Boc)-OSu

Description:
Z-D-Lys(Boc)-OSu, also known as Z-lysine (Boc)-N-hydroxysuccinimide ester, is a chemical compound commonly used in peptide synthesis and bioconjugation. It features a protected lysine residue, where the amino group is modified with a Boc (tert-butyloxycarbonyl) protecting group, and the carboxylic acid is activated as a succinimidyl ester. This structure allows for selective coupling reactions with other amino acids or biomolecules, facilitating the formation of peptide bonds. The Z (benzyloxycarbonyl) group provides additional protection for the amino group during synthesis, enhancing the stability and reactivity of the compound. Z-D-Lys(Boc)-OSu is typically used in solid-phase peptide synthesis and can be employed in various applications, including drug development and the creation of peptide-based therapeutics. Its reactivity with nucleophiles, such as amines, makes it a valuable tool in the field of medicinal chemistry and biochemistry. Proper handling and storage conditions are essential to maintain its integrity and reactivity.
Formula:C23H31N3O8
InChI:InChI=1S/C23H31N3O8/c1-23(2,3)33-21(30)24-14-8-7-11-17(20(29)34-26-18(27)12-13-19(26)28)25-22(31)32-15-16-9-5-4-6-10-16/h4-6,9-10,17H,7-8,11-15H2,1-3H3,(H,24,30)(H,25,31)/t17-/m1/s1
InChI key:NCFVVSXVXQRYFS-QGZVFWFLSA-N
SMILES:CC(C)(C)OC(=O)NCCCC[C@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OCC2=CC=CC=C2
Found 3 products.