CymitQuimica logo

CAS 78646-17-0

:

2,3,4,5-tetradeuterio-6-hydroxy-benzoic acid

Description:
2,3,4,5-Tetradeuterio-6-hydroxy-benzoic acid, with the CAS number 78646-17-0, is a deuterated derivative of salicylic acid, characterized by the substitution of four hydrogen atoms with deuterium at the 2, 3, 4, and 5 positions of the benzene ring. This compound retains the hydroxyl (-OH) group at the 6-position, which contributes to its acidic properties. The presence of deuterium, a stable isotope of hydrogen, can influence the compound's physical and chemical properties, such as its solubility, reactivity, and isotopic labeling in various applications, including NMR spectroscopy and metabolic studies. As a benzoic acid derivative, it exhibits typical carboxylic acid characteristics, including the ability to form salts and esters. The deuterated nature of this compound makes it particularly useful in research settings, where it can serve as a tracer or in studies involving kinetic isotope effects. Overall, 2,3,4,5-tetradeuterio-6-hydroxy-benzoic acid is a valuable compound in both synthetic and analytical chemistry.
Formula:C7H2D4O3
InChI:InChI=1/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10)/i1D,2D,3D,4D
InChI key:YGSDEFSMJLZEOE-RHQRLBAQSA-N
SMILES:c1(c(c(c(c(c1[2H])C(=O)O)O)[2H])[2H])[2H]
Synonyms:
  • 2-Hydroxy(< sup> 2< /sup> H< sub> 4< /sub> )benzoic acid
  • Benzoic-2,3,4,5-D< Sub> 4< /Sub> Acid, 6-Hydroxy-
Found 6 products.