CymitQuimica logo

CAS 786616-54-4

:

3-Amino-5-fluorobenzoic acid

Description:
3-Amino-5-fluorobenzoic acid is an aromatic amino acid derivative characterized by the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH) on a benzene ring, along with a fluorine atom at the meta position relative to the amino group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The presence of the amino group allows for potential interactions such as hydrogen bonding, which can influence its reactivity and solubility. The fluorine atom can impart unique electronic properties, potentially affecting the compound's biological activity and chemical reactivity. 3-Amino-5-fluorobenzoic acid may be utilized in various applications, including pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions.
Formula:C7H6FNO2
InChI:InChI=1/C7H6FNO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,9H2,(H,10,11)
InChI key:RYLBYCHERDTVAY-UHFFFAOYSA-N
SMILES:c1c(cc(cc1F)N)C(=O)O
Synonyms:
  • Benzoic Acid, 3-Amino-5-Fluoro-
Found 4 products.