CAS 78668-34-5
:3,6,9,15-tetraazabicyclo[9.3.1]pentadeca-1(15),11,13-triene
Description:
3,6,9,15-tetraazabicyclo[9.3.1]pentadeca-1(15),11,13-triene is a complex organic compound characterized by its unique bicyclic structure that incorporates four nitrogen atoms within its framework. This compound features a bicyclic arrangement, which contributes to its rigidity and potential for interesting chemical reactivity. The presence of multiple nitrogen atoms suggests that it may exhibit basic properties and could participate in coordination chemistry, potentially forming complexes with metal ions. The triene component indicates the presence of conjugated double bonds, which can impart significant electronic properties, such as increased stability and reactivity in certain conditions. Additionally, the compound's structure may allow for various stereochemical configurations, influencing its physical and chemical behavior. Due to its intricate structure, 3,6,9,15-tetraazabicyclo[9.3.1]pentadeca-1(15),11,13-triene may have applications in fields such as materials science, medicinal chemistry, or as a ligand in coordination complexes. However, specific applications and properties would depend on further empirical studies and characterization.
Formula:C11H18N4
InChI:InChI=1/C11H18N4/c1-2-10-8-13-6-4-12-5-7-14-9-11(3-1)15-10/h1-3,12-14H,4-9H2
Synonyms:- Pyclen
- 3,6,9,15-Tetraazabicyclo[9.3.1]pentadeca-1(15),11,13-triene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,6,9,15-TETRAAZABICYCLO[9.3.1]PENTADECA-1(15),11,13-TRIENE
CAS:Formula:C11H18N4Purity:95%Molecular weight:206.28741,4,7,10-Tetraaza-2,6-Pyridinophane
CAS:1,4,7,10-Tetraaza-2,6-PyridinophanePurity:95%Molecular weight:206.29g/molPyclen
CAS:3,6,9,15-Tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-triene is a ligand that binds to the nicotinic acetylcholine receptor (nAChR). It is an antagonist of nAChRs and blocks their activation by acetylcholine. 3,6,9,15-Tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-triene is used as a research tool to study the function of nAChRs in cell biology and pharmacology. The ligand has been shown to be an inhibitor of ion channels, such as potassium channels.
Formula:C11H18N4Purity:Min. 95%Molecular weight:206.29 g/molPyclen
CAS:Pyclen prevents and disrupts Cu2+-induced AB1-40 aggregation and inhibits oxidative stress cell death.Formula:C11H18N4Purity:98%Color and Shape:SolidMolecular weight:206.29



