CAS 78668-34-5

3,6,9,15-tetraazabicyclo[9.3.1]pentadeca-1(15),11,13-triene

Description:

3,6,9,15-tetraazabicyclo[9.3.1]pentadeca-1(15),11,13-triene is a complex organic compound characterized by its unique bicyclic structure that incorporates four nitrogen atoms within its framework. This compound features a bicyclic arrangement, which contributes to its rigidity and potential for interesting chemical reactivity. The presence of multiple nitrogen atoms suggests that it may exhibit basic properties and could participate in coordination chemistry, potentially forming complexes with metal ions. The triene component indicates the presence of conjugated double bonds, which can impart significant electronic properties, such as increased stability and reactivity in certain conditions. Additionally, the compound's structure may allow for various stereochemical configurations, influencing its physical and chemical behavior. Due to its intricate structure, 3,6,9,15-tetraazabicyclo[9.3.1]pentadeca-1(15),11,13-triene may have applications in fields such as materials science, medicinal chemistry, or as a ligand in coordination complexes. However, specific applications and properties would depend on further empirical studies and characterization.

Formula: C₁₁H₁₈N₄

InChI: InChI=1/C11H18N4/c1-2-10-8-13-6-4-12-5-7-14-9-11(3-1)15-10/h1-3,12-14H,4-9H2

InChI key: LNMUPMQUMCDOKO-UHFFFAOYSA-N

SMILES: C1CNCC2=NC(=CC=C2)CNCCN1

Synonyms:

• Pyclen
• 3,6,9,15-Tetraazabicyclo[9.3.1]pentadeca-1(15),11,13-triene

1,4,7,10-Tetraaza-2,6-Pyridinophane

CAS: 78668-34-5

1,4,7,10-Tetraaza-2,6-Pyridinophane

Formula: C₁₁H₁₈N₄

Purity: 95%

Molecular weight: 206.29

Ref: 54-OR1025867

1,4,7,10-Tetraaza-2,6-Pyridinophane

CAS: 78668-34-5

Formula: C₁₁H₁₈N₄

Purity: 95%

Molecular weight: 206.2874

Ref: IN-DA0058RR

Pyclen

CAS: 78668-34-5

Formula: C₁₁H₁₈N₄

Molecular weight: 206.29

Ref: 4Z-P-496001

Pyclen

CAS: 78668-34-5

3,6,9,15-Tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-triene is a ligand that binds to the nicotinic acetylcholine receptor (nAChR). It is an antagonist of nAChRs and blocks their activation by acetylcholine. 3,6,9,15-Tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-triene is used as a research tool to study the function of nAChRs in cell biology and pharmacology. The ligand has been shown to be an inhibitor of ion channels, such as potassium channels.

Formula: C₁₁H₁₈N₄

Purity: Min. 95%

Molecular weight: 206.29 g/mol

Ref: 3D-DDA66834

Pyclen

CAS: 78668-34-5

Pyclen prevents and disrupts Cu2+-induced AB1-40 aggregation and inhibits oxidative stress cell death.

Formula: C₁₁H₁₈N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 206.29

Ref: TM-T26002