CymitQuimica logo

CAS 78686-87-0

:

2,5-Dichloro-3-pyridinecarbonyl chloride

Description:
2,5-Dichloro-3-pyridinecarbonyl chloride is a chemical compound characterized by its pyridine ring structure, which is substituted at the 2 and 5 positions with chlorine atoms and at the 3 position with a carbonyl chloride group. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its reactivity, particularly due to the presence of the carbonyl chloride functional group, which can participate in acylation reactions and is a useful intermediate in organic synthesis. The chlorine substituents enhance its electrophilic character, making it a potential reagent in various chemical transformations. Additionally, it may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures during use. As with many chlorinated compounds, it may also pose environmental concerns, particularly regarding persistence and bioaccumulation. Proper storage conditions, such as keeping it in a cool, dry place away from light, are essential to maintain its stability and prevent degradation.
Formula:C6H2Cl3NO
InChI:InChI=1S/C6H2Cl3NO/c7-3-1-4(6(9)11)5(8)10-2-3/h1-2H
InChI key:InChIKey=VRJMAKCJTSZUQR-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=C(Cl)N=CC(Cl)=C1
Synonyms:
  • 2,5-Dichloropyridine-3-carbonyl chloride
  • 2,5-Dichloro-3-pyridinecarbonyl chloride
  • 2,5-Dichloronicotinoyl chloride
  • 3-Pyridinecarbonyl chloride, 2,5-dichloro-
Found 3 products.