CymitQuimica logo

CAS 78697-25-3

:

Benzenemethanaminium, 4-benzoyl-N,N,N-trimethyl-, chloride (1:1)

Description:
Benzenemethanaminium, 4-benzoyl-N,N,N-trimethyl-, chloride (1:1), commonly referred to as a quaternary ammonium compound, is characterized by its cationic structure, which includes a benzyl group and a trimethylammonium moiety. This compound typically exhibits properties such as solubility in polar solvents due to its ionic nature, and it may display antimicrobial activity, making it useful in various applications, including as a surfactant or in pharmaceuticals. The presence of the benzoyl group can contribute to its reactivity and potential as a precursor in organic synthesis. Additionally, the chloride ion serves as a counterion, influencing the compound's stability and solubility. Its molecular structure allows for interactions with biological membranes, which can be significant in drug delivery systems. Overall, this compound's unique characteristics stem from its quaternary ammonium structure, making it a subject of interest in both industrial and research settings.
Formula:C17H20NO·Cl
InChI:InChI=1S/C17H20NO.ClH/c1-18(2,3)13-14-9-11-16(12-10-14)17(19)15-7-5-4-6-8-15;/h4-12H,13H2,1-3H3;1H/q+1;/p-1
InChI key:InChIKey=UROHSXQUJQQUOO-UHFFFAOYSA-M
SMILES:C(=O)(C1=CC=C(C[N+](C)(C)C)C=C1)C2=CC=CC=C2.[Cl-]
Synonyms:
  • Benzenemethanaminium, 4-benzoyl-N,N,N-trimethyl-, chloride
  • Benzenemethanaminium, 4-benzoyl-N,N,N-trimethyl-, chloride (1:1)
  • Quantacure BTC
  • Kayacure BTC
  • (4-Benzoylbenzyl)trimethylammonium chloride
Found 3 products.