CAS 78701-57-2
:N-{2-methoxy-4-[(methylsulfonyl)amino]phenyl}butanamide
Description:
N-{2-methoxy-4-[(methylsulfonyl)amino]phenyl}butanamide, with the CAS number 78701-57-2, is a chemical compound characterized by its specific functional groups and structural features. It contains a butanamide moiety, indicating the presence of an amide functional group attached to a butane chain. The compound also features a methoxy group (-OCH3) and a methylsulfonylamino group (-SO2-CH3-NH-) attached to a phenyl ring, which contributes to its potential biological activity. The presence of the sulfonyl group may enhance solubility and influence the compound's interaction with biological targets. This compound is likely to exhibit properties typical of amides, such as moderate polarity and potential for hydrogen bonding, which can affect its pharmacokinetics and pharmacodynamics. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological activities, toxicity, and stability would require further investigation through empirical studies.
Formula:C12H18N2O4S
InChI:InChI=1/C12H18N2O4S/c1-4-5-12(15)13-10-7-6-9(8-11(10)18-2)14-19(3,16)17/h6-8,14H,4-5H2,1-3H3,(H,13,15)
InChI key:ZVHGJYNUMGWJPL-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=C1)CC2=CC(=CC(=C2O)CC3=CC(=C(C=C3)C)C)Cl)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
