CymitQuimica logo

CAS 78784-66-4

:

3-Chloro-6-(3-pyridinyl)pyridazine

Description:
3-Chloro-6-(3-pyridinyl)pyridazine is a heterocyclic organic compound characterized by its pyridazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a pyridine substituent at the 6-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. It is of interest in medicinal chemistry and may possess biological activity due to its structural features, which can interact with various biological targets. The presence of both chlorine and pyridine groups can influence its reactivity, making it a potential candidate for further chemical modifications or as a lead compound in drug development. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can exhibit varying degrees of environmental and health impacts. Overall, 3-Chloro-6-(3-pyridinyl)pyridazine represents a class of compounds that are valuable in research and development within the field of organic and medicinal chemistry.
Formula:C9H6ClN3
InChI:InChI=1S/C9H6ClN3/c10-9-4-3-8(12-13-9)7-2-1-5-11-6-7/h1-6H
InChI key:InChIKey=ORJRJVSMOMIYGH-UHFFFAOYSA-N
SMILES:ClC1=CC=C(N=N1)C=2C=CC=NC2
Synonyms:
  • 3-Chloro-6-(3-pyridinyl)pyridazine
  • Pyridazine, 3-chloro-6-(3-pyridinyl)-
Found 3 products.