CymitQuimica logo

CAS 78813-85-1

:

3-cyclohexylpyrrolidine

Description:
3-Cyclohexylpyrrolidine is a cyclic organic compound characterized by a pyrrolidine ring substituted with a cyclohexyl group at the third position. This compound typically exhibits properties associated with both cyclic amines and aliphatic hydrocarbons. It is a colorless to pale yellow liquid with a distinctive odor, and it is soluble in organic solvents while having limited solubility in water due to its hydrophobic cyclohexyl group. The presence of the nitrogen atom in the pyrrolidine ring contributes to its basicity and potential reactivity, making it of interest in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, 3-cyclohexylpyrrolidine may exhibit interesting biological activities, which can be explored for medicinal chemistry purposes. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid inhalation or skin contact. Overall, its unique structure and properties make it a compound of interest in both academic and industrial research settings.
Formula:C10H19N
InChI:InChI=1/C10H19N/c1-2-4-9(5-3-1)10-6-7-11-8-10/h9-11H,1-8H2
InChI key:PJQCUMVGSKEOMN-UHFFFAOYSA-N
SMILES:C1CCC(CC1)C1CCNC1
Found 2 products.