CymitQuimica logo

CAS 78842-74-7

:

Methyl 3-(4-bromophenyl)-1H-pyrazole-5-carboxylate

Description:
Methyl 3-(4-bromophenyl)-1H-pyrazole-5-carboxylate is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a bromophenyl group at the 3-position of the pyrazole enhances its reactivity and potential applications in medicinal chemistry. The carboxylate functional group at the 5-position, along with the methyl ester, contributes to its solubility and reactivity, making it a versatile intermediate in organic synthesis. This compound may exhibit biological activity, which is often explored in the context of drug development, particularly in the fields of anti-inflammatory or anticancer research. Its molecular structure allows for various substitution reactions, making it a valuable building block in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the presence of bromine, which can pose environmental and health risks. Overall, Methyl 3-(4-bromophenyl)-1H-pyrazole-5-carboxylate is a significant compound in the realm of organic and medicinal chemistry.
Formula:C11H9BrN2O2
InChI:InChI=1S/C11H9BrN2O2/c1-16-11(15)10-6-9(13-14-10)7-2-4-8(12)5-3-7/h2-6H,1H3,(H,13,14)
InChI key:IRKMOAWZRZMSCU-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC(=NN1)C2=CC=C(C=C2)Br
Found 3 products.