CymitQuimica logo

CAS 78863-99-7

:

7-Bromo-2,3,4,9-tetrahydro-1H-carbazole

Description:
7-Bromo-2,3,4,9-tetrahydro-1H-carbazole is a chemical compound characterized by its bicyclic structure, which includes a carbazole moiety with a bromine substituent at the 7-position. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural features. It is generally a solid at room temperature and may be soluble in organic solvents. The presence of the bromine atom can influence its reactivity, making it a candidate for various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, compounds like this one are often studied for their potential applications in pharmaceuticals, organic electronics, and as intermediates in organic synthesis. Its molecular structure contributes to its unique physical and chemical properties, which can be further explored through spectroscopic methods such as NMR and mass spectrometry. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.
Formula:C12H12BrN
InChI:InChI=1S/C12H12BrN/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h5-7,14H,1-4H2
InChI key:InChIKey=ZNEUGUWVPAHTNJ-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(C3=C(N2)CCCC3)=CC1
Synonyms:
  • 7-Bromo-2,3,4,9-tetrahydro-1H-carbazole
  • 1H-Carbazole, 7-bromo-2,3,4,9-tetrahydro-
  • 7-Bromo-1,2,3,4-tetrahydrocarbazole
  • Carbazole, 7-bromo-1,2,3,4-tetrahydro-
Found 3 products.