CymitQuimica logo

CAS 78887-48-6

:

Cholesterol-3,4-13C2

Description:
Cholesterol-3,4-13C2 is a stable isotope-labeled form of cholesterol, which is a vital sterol and lipid molecule found in cell membranes and is a precursor for steroid hormones, bile acids, and vitamin D. The designation "3,4-13C2" indicates that two carbon atoms in the cholesterol molecule have been replaced with their heavier isotope, carbon-13, which is useful in various biochemical and metabolic studies. This compound retains the same chemical structure and biological functions as natural cholesterol but allows for enhanced tracking and analysis in research, particularly in studies involving lipid metabolism and cellular processes. Cholesterol itself is characterized by a multi-ring structure, hydrophobic properties, and a hydroxyl group that contributes to its amphipathic nature. The presence of the carbon-13 isotopes can be detected using techniques such as nuclear magnetic resonance (NMR) spectroscopy or mass spectrometry, providing insights into metabolic pathways and the dynamics of cholesterol in biological systems.
Formula:C27H46O
InChI:InChI=1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1/i17+1,21+1
InChI key:HVYWMOMLDIMFJA-WKKCFSIESA-N
SMILES:C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[13C@@H]([13CH2]4)O)C)C
Found 5 products.