CymitQuimica logo

CAS 78995-98-9

:

3,3-dideuterio-6,6-dimethyl-2-(trideuteriomethyl)cyclohexene-1-carbaldehyde

Description:
3,3-Dideuterio-6,6-dimethyl-2-(trideuteriomethyl)cyclohexene-1-carbaldehyde is a deuterated organic compound characterized by its unique isotopic composition, which includes deuterium atoms replacing hydrogen in specific positions. This compound features a cyclohexene ring, indicating it has a cyclic structure with a double bond, contributing to its reactivity and stability. The presence of multiple methyl groups enhances its steric bulk, influencing its physical properties such as boiling point and solubility. The aldehyde functional group (-CHO) at the end of the cyclohexene ring introduces reactivity typical of aldehydes, allowing for further chemical transformations. The deuterium substitution can be advantageous in studies involving NMR spectroscopy, as it provides insights into molecular dynamics and interactions without the interference of hydrogen signals. Overall, this compound is of interest in fields such as organic synthesis, medicinal chemistry, and isotopic labeling studies, where understanding the behavior of molecules with different isotopes is crucial.
Formula:C10H11D5O
InChI:InChI=1/C10H16O/c1-8-5-4-6-10(2,3)9(8)7-11/h7H,4-6H2,1-3H3/i1D3,5D2
InChI key:MOQGCGNUWBPGTQ-RPIBLTHZSA-N
SMILES:C(C1=C(C=O)C(C)(C)CCC1([2H])[2H])([2H])([2H])[2H]
Found 4 products.