CymitQuimica logo

CAS 790164-97-5

:

4-Amino-1-methyl-1H-pyrazole-5-carboxylic acid

Description:
4-Amino-1-methyl-1H-pyrazole-5-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which features an amino group and a carboxylic acid functional group. This compound typically appears as a crystalline solid and is soluble in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The amino group contributes to its basicity, making it a potential candidate for various chemical reactions, including those involving nucleophilic substitution. Its molecular structure allows for potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The compound's reactivity can be influenced by the substituents on the pyrazole ring, which can affect its interaction with biological systems. Additionally, the presence of both amino and carboxylic acid functionalities suggests that it may participate in acid-base reactions, making it versatile in synthetic chemistry. Overall, 4-Amino-1-methyl-1H-pyrazole-5-carboxylic acid is a compound of interest in medicinal chemistry and related fields.
Formula:C5H7N3O2
InChI:InChI=1S/C5H7N3O2/c1-8-4(5(9)10)3(6)2-7-8/h2H,6H2,1H3,(H,9,10)
InChI key:InChIKey=KMLOGBKLHVLMHE-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C=NN1C
Synonyms:
  • 1H-Pyrazole-5-carboxylic acid, 4-amino-1-methyl-
  • 1H-Pyrazole-5-carboxylicacid,4-amino-1-methyl-(9CI)
  • 4-Amino-1-methyl-1H-pyrazole-5-carboxylic acid
Found 3 products.