CymitQuimica logo

CAS 79023-51-1

:

Isoquinoline, 3,4-dihydro-1,3,3-trimethyl-

Description:
Isoquinoline, 3,4-dihydro-1,3,3-trimethyl- is a bicyclic organic compound that belongs to the isoquinoline family, characterized by a fused benzene and pyridine ring structure. This specific compound features a saturated dihydro form, indicating the presence of two additional hydrogen atoms compared to its fully unsaturated counterpart. The trimethyl groups suggest that there are three methyl substituents attached to the nitrogen-containing ring, which can influence its chemical reactivity and physical properties. Typically, isoquinolines exhibit aromatic characteristics, but the dihydro form may display different reactivity patterns due to the saturation of the ring. This compound may be of interest in various fields, including medicinal chemistry, due to its potential biological activities. Its properties, such as solubility, boiling point, and melting point, can vary significantly based on the presence of the methyl groups and the saturation of the ring. As with many organic compounds, safety and handling precautions should be observed, as isoquinoline derivatives can exhibit toxicity or other hazardous characteristics.
Formula:C12H15N
InChI:InChI=1S/C12H15N/c1-9-11-7-5-4-6-10(11)8-12(2,3)13-9/h4-7H,8H2,1-3H3
InChI key:HFNOAVXTUXLYNM-UHFFFAOYSA-N
SMILES:CC1=NC(CC2=CC=CC=C12)(C)C
Synonyms:
  • 1,3,3-Trimethyl-3,4-dihydroisoquinoline
  • 3,4-dihydro-1,3,3-trimethylisoquinoline.
  • Isoquinoline, 3,4-dihydro-1,3,3-trimethyl-
Found 4 products.