CymitQuimica logo

CAS 790272-16-1

:

1-[(3,4-Dihydro-2H-1,5-benzodioxepin-7-yl)sulfonyl]-4-piperidinecarboxylic acid

Description:
1-[(3,4-Dihydro-2H-1,5-benzodioxepin-7-yl)sulfonyl]-4-piperidinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring and a sulfonyl group attached to a benzodioxepin moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of the carboxylic acid functional group. The sulfonyl group enhances its potential for interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific receptors or enzymes. The compound may also exhibit specific stereochemical properties, which can influence its biological activity and pharmacokinetics. As with many organic compounds, stability can be affected by environmental factors such as pH and temperature. Overall, this compound represents a unique scaffold that could be explored for therapeutic applications, particularly in areas requiring modulation of biological pathways.
Formula:C15H19NO6S
InChI:InChI=1S/C15H19NO6S/c17-15(18)11-4-6-16(7-5-11)23(19,20)12-2-3-13-14(10-12)22-9-1-8-21-13/h2-3,10-11H,1,4-9H2,(H,17,18)
InChI key:InChIKey=AZEWYWODSHSGGT-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C=1C=C2C(=CC1)OCCCO2)N3CCC(C(O)=O)CC3
Synonyms:
  • 1-[(3,4-Dihydro-2H-1,5-benzodioxepin-7-yl)sulfonyl]-4-piperidinecarboxylic acid
  • 4-Piperidinecarboxylic acid, 1-[(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)sulfonyl]-
Found 1 products.