CymitQuimica logo

CAS 79050-49-0

:

4,5-dimethylbenzo[d]thiazol-2-amine

Description:
4,5-Dimethylbenzo[d]thiazol-2-amine is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features two methyl groups attached to the benzene ring, specifically at the 4 and 5 positions, and an amino group (-NH2) at the 2 position of the thiazole. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The thiazole moiety is known for its biological activity, making compounds like 4,5-dimethylbenzo[d]thiazol-2-amine of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and interaction with other molecules can be influenced by the substituents on the aromatic ring and the thiazole, which may affect its utility in synthesis and as a biological agent. Overall, this compound exemplifies the diverse chemistry of heterocyclic compounds and their significance in drug development and material science.
Formula:C9H10N2S
InChI:InChI=1S/C9H10N2S/c1-5-3-4-7-8(6(5)2)11-9(10)12-7/h3-4H,1-2H3,(H2,10,11)
InChI key:ZAJVZJPXCSIEQP-UHFFFAOYSA-N
SMILES:CC1=C(C2=C(C=C1)SC(=N2)N)C
Found 4 products.