CAS 790676-40-3
:(5S)-3-benzyl-5-ethyl-5-phenyl-imidazolidine-2,4-dione
Description:
(5S)-3-benzyl-5-ethyl-5-phenyl-imidazolidine-2,4-dione, with the CAS number 790676-40-3, is a chemical compound characterized by its imidazolidine core structure, which features two carbonyl groups at positions 2 and 4. This compound exhibits chirality, with the (5S) designation indicating a specific stereochemistry that can influence its biological activity and interactions. The presence of the benzyl, ethyl, and phenyl substituents contributes to its hydrophobic characteristics, potentially affecting its solubility and reactivity. Imidazolidine derivatives are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The compound may exhibit various functional properties, such as acting as a ligand or a precursor in organic synthesis. Its stability, reactivity, and interactions with biological systems can be influenced by the specific arrangement of its substituents and the overall molecular conformation. Further studies would be necessary to elucidate its full range of chemical and biological properties.
Formula:C18H18N2O2
InChI:InChI=1/C18H18N2O2/c1-2-18(15-11-7-4-8-12-15)16(21)20(17(22)19-18)13-14-9-5-3-6-10-14/h3-12H,2,13H2,1H3,(H,19,22)/t18-/m0/s1
SMILES:CC[C@]1(c2ccccc2)C(=O)N(Cc2ccccc2)C(=N1)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(S)-(+)-N-3-Benzylnirvanol
CAS:(S)-(+)-N-3-Benzylnirvanol is a cytochrome P450 CYP2C19 inhibitor with a ki value of 82.5μM for CYP2C9 and 0.25μM for CYP2C19.Cost-effective and quality-assured.Formula:C18H18N2O2Purity:98.90%Color and Shape:SoildMolecular weight:294.35(+)-N-3-Benzylnirvanol
CAS:Formula:C18H18N2O2Purity:(HPLC) ≥ 98.0%Color and Shape:White to off-white powderMolecular weight:294.35(S)-(+)-N-3-Benzylnirvanol
CAS:Controlled ProductApplications It is a potent and selective human CYP2C19 inhibitor.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Suzuki, H., et al.: Drug Metab. Dispos., 30, 235 (2002), Robert, L., et al.: Drug Metab. Dispos., 31, 343 (2003),Formula:C18H18N2O2Color and Shape:White To Off-WhiteMolecular weight:294.35





