CymitQuimica logo

CAS 790676-40-3

:

(5S)-3-benzyl-5-ethyl-5-phenyl-imidazolidine-2,4-dione

Description:
(5S)-3-benzyl-5-ethyl-5-phenyl-imidazolidine-2,4-dione, with the CAS number 790676-40-3, is a chemical compound characterized by its imidazolidine core structure, which features two carbonyl groups at positions 2 and 4. This compound exhibits chirality, with the (5S) designation indicating a specific stereochemistry that can influence its biological activity and interactions. The presence of the benzyl, ethyl, and phenyl substituents contributes to its hydrophobic characteristics, potentially affecting its solubility and reactivity. Imidazolidine derivatives are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The compound may exhibit various functional properties, such as acting as a ligand or a precursor in organic synthesis. Its stability, reactivity, and interactions with biological systems can be influenced by the specific arrangement of its substituents and the overall molecular conformation. Further studies would be necessary to elucidate its full range of chemical and biological properties.
Formula:C18H18N2O2
InChI:InChI=1/C18H18N2O2/c1-2-18(15-11-7-4-8-12-15)16(21)20(17(22)19-18)13-14-9-5-3-6-10-14/h3-12H,2,13H2,1H3,(H,19,22)/t18-/m0/s1
InChI key:ZMZDHUHMXXALFX-SFHVURJKSA-N
SMILES:CC[C@]1(c2ccccc2)C(=O)N(Cc2ccccc2)C(=N1)O
Found 8 products.