CymitQuimica logo

CAS 79099-00-6

:

tert-butyl 4-[(2-aminophenyl)amino]piperidine-1-carboxylate

Description:
Tert-butyl 4-[(2-aminophenyl)amino]piperidine-1-carboxylate, with the CAS number 79099-00-6, is an organic compound characterized by its complex structure, which includes a piperidine ring, an amino group, and a tert-butyl ester functional group. This compound typically exhibits properties associated with amines and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group. The piperidine moiety contributes to its cyclic structure, which can influence its biological activity and interaction with other molecules. The tert-butyl group enhances the lipophilicity of the compound, potentially affecting its pharmacokinetic properties. Additionally, the presence of the amino group may allow for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound's unique structural features suggest potential applications in drug development and research, particularly in areas related to neuropharmacology or as a building block for more complex molecules.
Formula:C16H25N3O2
InChI:InChI=1/C16H25N3O2/c1-16(2,3)21-15(20)19-10-8-12(9-11-19)18-14-7-5-4-6-13(14)17/h4-7,12,18H,8-11,17H2,1-3H3
InChI key:QAMKZPZMTWAMLU-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)Nc1ccccc1N
Synonyms:
  • tert-Butyl 4-[(2-aminophenyl)amino]piperidine-1-carboxylate
Found 3 products.