CymitQuimica logo

CAS 791078-04-1

:

2-[2-(bromomethyl)phenyl]thiophene

Description:
2-[2-(Bromomethyl)phenyl]thiophene is an organic compound characterized by its unique structure, which includes a thiophene ring and a bromomethyl-substituted phenyl group. The presence of the bromomethyl group introduces both a halogen and a reactive site, making the compound potentially useful in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The thiophene moiety contributes to the compound's aromaticity and can influence its electronic properties, making it of interest in materials science, particularly in organic electronics and photonic applications. Additionally, the compound may exhibit interesting biological activities due to the presence of the bromine atom, which can enhance lipophilicity and alter the compound's interaction with biological targets. Its synthesis typically involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Overall, 2-[2-(bromomethyl)phenyl]thiophene represents a versatile building block in organic synthesis and materials chemistry.
Formula:C11H9BrS
InChI:InChI=1/C11H9BrS/c12-8-9-4-1-2-5-10(9)11-6-3-7-13-11/h1-7H,8H2
SMILES:c1ccc(c(c1)CBr)c1cccs1
Found 1 products.