CymitQuimica logo

CAS 79110-05-7

:

1-(2-Fluoro-5-nitrophenyl)ethanone

Description:
1-(2-Fluoro-5-nitrophenyl)ethanone, with the CAS number 79110-05-7, is an organic compound characterized by its functional groups and molecular structure. It features a phenyl ring substituted with a fluorine atom and a nitro group, which significantly influence its chemical reactivity and physical properties. The presence of the ethanone moiety indicates that it is a ketone, contributing to its potential as a reactive electrophile in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its aromatic nature. The fluorine and nitro substituents can enhance its polarity and reactivity, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's unique structure may impart specific biological activities, warranting further investigation in medicinal chemistry. Safety data should be consulted for handling and storage, as compounds with nitro groups can be sensitive and potentially hazardous.
Formula:C8H6FNO3
InChI:InChI=1/C8H6FNO3/c1-5(11)7-4-6(10(12)13)2-3-8(7)9/h2-4H,1H3
InChI key:BCXOSCQTHVTUET-UHFFFAOYSA-N
SMILES:CC(=O)c1cc(ccc1F)N(=O)=O
Synonyms:
  • Ethanone, 1-(2-Fluoro-5-Nitrophenyl)-
  • 2'-Fluoro-5'-nitroacetophenone
  • 1-(2-Fluoro-5-Nitrophenyl)Ethan-1-One
Found 5 products.