CymitQuimica logo

CAS 791104-62-6

:

1H-Pyrrole-1-carboxamide,3-ethyl-2,5-dihydro-4-methyl-N-[2-[3-[[[[(trans-4-methylcyclohexyl)amino]carbonyl]amino]sulfonyl]phenyl]ethyl]-2-oxo-

Description:
1H-Pyrrole-1-carboxamide, 3-ethyl-2,5-dihydro-4-methyl-N-[2-[3-[[[[(trans-4-methylcyclohexyl)amino]carbonyl]amino]sulfonyl]phenyl]ethyl]-2-oxo- is a complex organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing one nitrogen atom. This compound features multiple functional groups, including a carboxamide, sulfonamide, and various alkyl substituents, which contribute to its chemical reactivity and potential biological activity. The presence of the ethyl and methyl groups indicates that it has branched alkyl chains, which can influence its solubility and interaction with biological systems. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its CAS number, 791104-62-6, allows for easy identification in chemical databases. Overall, the unique combination of functional groups and structural features makes this compound of interest for further research and development in various chemical and pharmaceutical applications.
Formula:C24H34N4O5S
InChI:InChI=1S/C24H34N4O5S/c1-4-21-17(3)15-28(22(21)29)24(31)25-13-12-18-6-5-7-20(14-18)34(32,33)27-23(30)26-19-10-8-16(2)9-11-19/h5-7,14,16,19H,4,8-13,15H2,1-3H3,(H,25,31)(H2,26,27,30)
InChI key:XBXROPCBZLGQMA-UHFFFAOYSA-N
SMILES:CCC1=C(CN(C1=O)C(=O)NCCC2=CC(=CC=C2)S(=O)(=O)NC(=O)NC3CCC(CC3)C)C
Found 9 products.