CymitQuimica logo

CAS 791137-26-3

:

5-Bromo-2-chloro-4-hydroxybenzoic acid

Description:
5-Bromo-2-chloro-4-hydroxybenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with bromine, chlorine, and a hydroxyl group, as well as a carboxylic acid functional group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the hydroxyl and carboxylic acid groups. It exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification and nucleophilic substitution. The presence of halogen substituents (bromine and chlorine) can influence its reactivity and stability, making it useful in synthetic organic chemistry. Additionally, this compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of other chemical entities. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and disposal procedures should be followed.
Formula:C7H4BrClO3
InChI:InChI=1S/C7H4BrClO3/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2,10H,(H,11,12)
InChI key:InChIKey=OFURCEMHMDXJAT-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)C=C(O)C(Br)=C1
Synonyms:
  • 5-Bromo-2-chloro-4-hydroxybenzoic acid
  • Benzoic acid, 5-bromo-2-chloro-4-hydroxy-
Found 3 products.