CAS 791601-03-1

β-(2-Chlorophenyl)-1-pyrrolidineethanamine

Description:

β-(2-Chlorophenyl)-1-pyrrolidineethanamine, identified by its CAS number 791601-03-1, is a chemical compound that belongs to the class of substituted phenylpyrrolidine derivatives. This substance features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with a 2-chlorophenyl group, contributing to its unique properties. The presence of the chlorophenyl moiety can influence the compound's lipophilicity and biological activity, potentially affecting its interaction with various receptors or enzymes. The amine functional group in the structure suggests that it may exhibit basic properties, allowing it to participate in hydrogen bonding and interact with biological systems. While specific pharmacological data may vary, compounds of this nature are often investigated for their potential therapeutic applications, particularly in the fields of neuroscience and medicinal chemistry. As with many chemical substances, safety and handling precautions are essential, given the potential for toxicity or reactivity associated with amines and halogenated compounds.

Formula: C₁₂H₁₇ClN₂

InChI: InChI=1S/C12H17ClN2/c13-11-6-2-1-5-10(11)12(9-14)15-7-3-4-8-15/h1-2,5-6,12H,3-4,7-9,14H2

InChI key: InChIKey=IZHQBEMKODNZFF-UHFFFAOYSA-N

SMILES: C(CN)(C1=C(Cl)C=CC=C1)N2CCCC2

2-(2-Chlorophenyl)-2-pyrrolidin-1-ylethanamine

CAS: 791601-03-1

Formula: C₁₂H₁₇ClN₂

Molecular weight: 224.7298

Ref: IN-DA00G30K

2-(2-Chloro-phenyl)-2-pyrrolidin-1-yl-ethylamine

CAS: 791601-03-1

Versatile small molecule scaffold

Formula: C₁₂H₁₇ClN₂

Purity: Min. 95%

Molecular weight: 224.73 g/mol

Ref: 3D-RGB60103