CymitQuimica logo

CAS 791601-03-1

:

β-(2-Chlorophenyl)-1-pyrrolidineethanamine

Description:
β-(2-Chlorophenyl)-1-pyrrolidineethanamine, identified by its CAS number 791601-03-1, is a chemical compound that belongs to the class of substituted phenylpyrrolidine derivatives. This substance features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with a 2-chlorophenyl group, contributing to its unique properties. The presence of the chlorophenyl moiety can influence the compound's lipophilicity and biological activity, potentially affecting its interaction with various receptors or enzymes. The amine functional group in the structure suggests that it may exhibit basic properties, allowing it to participate in hydrogen bonding and interact with biological systems. While specific pharmacological data may vary, compounds of this nature are often investigated for their potential therapeutic applications, particularly in the fields of neuroscience and medicinal chemistry. As with many chemical substances, safety and handling precautions are essential, given the potential for toxicity or reactivity associated with amines and halogenated compounds.
Formula:C12H17ClN2
InChI:InChI=1S/C12H17ClN2/c13-11-6-2-1-5-10(11)12(9-14)15-7-3-4-8-15/h1-2,5-6,12H,3-4,7-9,14H2
InChI key:InChIKey=IZHQBEMKODNZFF-UHFFFAOYSA-N
SMILES:C(CN)(C1=C(Cl)C=CC=C1)N2CCCC2
Found 2 products.