CAS 79416-27-6

Pentanoic acid, 5-amino-4-oxo-, methyl ester, hydrochloride (1:1)

Description:

Pentanoic acid, 5-amino-4-oxo-, methyl ester, hydrochloride (1:1), with the CAS number 79416-27-6, is a chemical compound that features both an amino group and a carboxylic acid derivative, specifically as a methyl ester. This compound is characterized by its ability to form a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of the amino group suggests potential for interactions with biological systems, making it of interest in pharmaceutical applications. The methyl ester functional group indicates that it can undergo hydrolysis to release pentanoic acid and methanol, which may be relevant in metabolic processes. Additionally, the compound's structure implies that it may exhibit properties typical of both carboxylic acids and amines, such as acidity and basicity, which can affect its reactivity and interactions with other molecules. Overall, this compound's unique combination of functional groups positions it as a potentially versatile agent in various chemical and biological contexts.

Formula:C₆H₁₁NO₃·ClH

InChI:InChI=1S/C6H11NO3.ClH/c1-10-6(9)3-2-5(8)4-7;/h2-4,7H2,1H3;1H

InChI key:InChIKey=UJYSYPVQHFNBML-UHFFFAOYSA-N

SMILES:C(CCC(OC)=O)(CN)=O.Cl

Synonyms: