CAS 794568-91-5

1-(2-Chlorophenyl)-1,5-dihydro-6-[(2S)-3,3,3-trifluoro-2-methylpropyl]-4H-pyrazolo[3,4-d]pyrimidin-4-one

Description:

1-(2-Chlorophenyl)-1,5-dihydro-6-[(2S)-3,3,3-trifluoro-2-methylpropyl]-4H-pyrazolo[3,4-d]pyrimidin-4-one, with CAS number 794568-91-5, is a synthetic organic compound characterized by its complex heterocyclic structure. This compound features a pyrazolo[3,4-d]pyrimidine core, which is a bicyclic structure known for its biological activity, particularly in medicinal chemistry. The presence of a 2-chlorophenyl group contributes to its lipophilicity and potential interactions with biological targets. Additionally, the trifluoromethyl group enhances its metabolic stability and can influence its pharmacokinetic properties. The compound is likely to exhibit a range of biological activities, making it of interest in drug discovery and development. Its specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions dictated by its functional groups and overall structure. As with many compounds in this class, it may be evaluated for its efficacy and safety in various therapeutic applications.

Formula: C₁₅H₁₂ClF₃N₄O

InChI: InChI=1S/C15H12ClF3N4O/c1-8(15(17,18)19)6-12-21-13-9(14(24)22-12)7-20-23(13)11-5-3-2-4-10(11)16/h2-5,7-8H,6H2,1H3,(H,21,22,24)/t8-/m0/s1

InChI key: InChIKey=FFPXPXOAFQCNBS-QMMMGPOBSA-N

SMILES: O=C1C2=C(N(N=C2)C3=C(Cl)C=CC=C3)NC(C[C@@H](C(F)(F)F)C)=N1

Synonyms:

• 1-(2-Chlorophenyl)-1,5-dihydro-6-[(2S)-3,3,3-trifluoro-2-methylpropyl]-4H-pyrazolo[3,4-d]pyrimidin-4-one
• (S)-BAY 73-6691
• 4H-Pyrazolo[3,4-d]pyrimidin-4-one, 1-(2-chlorophenyl)-1,5-dihydro-6-[(2S)-3,3,3-trifluoro-2-methylpropyl]-

(S)-BAY 73-6691

CAS: 794568-91-5

(S)-BAY 73-6691

Formula: C₁₅H₁₂ClF₃N₄O

Purity: 98%

Molecular weight: 356.74

Ref: 54-PC110405

(S)-BAY 73-​6691 - Bio-X

CAS: 794568-91-5

Formula: C₁₅H₁₂ClF₃N₄O

Purity: 98%

Molecular weight: 356.7302

Ref: IN-DA01E9TE

(S)-BAY 73-6691

CAS: 794568-91-5

A potent inhibitor of phosphodiesterase type 9 (PDE9) tested in human and murine in vitro assays (IC50 values: 55 nM and 100 nM respectively). BAY 73-6691 induces long-term potentiation and improves memory in rodents. Has therapeutic potential for Alzheimer’s disease.

Formula: C₁₅H₁₂ClF₃N₄O

Purity: Min. 95%

Color and Shape: White To Off-White Solid

Molecular weight: 356.73 g/mol

Ref: 3D-BC162667

(S)-BAY 73-6691

CAS: 794568-91-5

Purity: 98%

Molecular weight: 356.07

Ref: 10-F551306