CAS 79528-48-6: [(2R,3S,4R,5R,6S)-3,4-diacetoxy-5-(1,3-dioxoisoindolin-2-yl)-6-methylsulfanyl-tetrahydropyran-2-yl]methyl acetate
Description:The chemical substance with the name "[(2R,3S,4R,5R,6S)-3,4-diacetoxy-5-(1,3-dioxoisoindolin-2-yl)-6-methylsulfanyl-tetrahydropyran-2-yl]methyl acetate" and CAS number 79528-48-6 is a complex organic compound characterized by its tetrahydropyran core structure, which is a six-membered ring containing one oxygen atom. This compound features multiple functional groups, including acetoxy groups, which are indicative of ester functionalities, and a methylthio group, suggesting the presence of sulfur. The presence of the isoindolin-2-yl moiety indicates potential biological activity, as isoindoline derivatives are often studied for their pharmacological properties. The stereochemistry of the molecule is specified by the R and S designations, which imply specific spatial arrangements of the atoms, potentially influencing its reactivity and interactions with biological targets. Overall, this compound's unique structure and functional groups may contribute to its chemical behavior and potential applications in medicinal chemistry or organic synthesis.
Formula:C21H23NO9S
InChI:InChI=1/C21H23NO9S/c1-10(23)28-9-15-17(29-11(2)24)18(30-12(3)25)16(21(31-15)32-4)22-19(26)13-7-5-6-8-14(13)20(22)27/h5-8,15-18,21H,9H2,1-4H3/t15-,16-,17-,18-,21+/m1/s1

Methyl3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranoside
Ref: IN-DA003RQ2
1g | 117.00 € | ||
5g | 307.00 € |

Methyl 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranoside
Ref: 3B-M1649
1g | 129.00 € | ||
5g | 448.00 € |

Methyl 3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-b-D-thioglucopyranoside
Ref: 3D-MM60568
1g | 184.00 € | ||
250mg | 134.00 € | ||
500mg | 150.00 € |