CymitQuimica logo

CAS 796729-03-8

:

5,6-Dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxylic acid

Description:
5,6-Dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxylic acid is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyrazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and potential reactivity due to the presence of both carboxylic acid and nitrogen-containing rings. The carboxylic acid functional group can participate in various chemical reactions, including esterification and amidation, making it a versatile building block in organic synthesis. Additionally, the bicyclic structure may contribute to its biological activity, as many compounds with similar frameworks are known to exhibit pharmacological properties. The compound's CAS number, 796729-03-8, allows for easy identification and retrieval of information in chemical databases. Overall, 5,6-Dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxylic acid is of interest in medicinal chemistry and materials science due to its structural features and potential applications.
Formula:C7H8N2O2
InChI:InChI=1S/C7H8N2O2/c10-7(11)6-4-5-2-1-3-9(5)8-6/h4H,1-3H2,(H,10,11)
InChI key:CSOYACNIOQHFQZ-UHFFFAOYSA-N
SMILES:C1CC2=CC(=NN2C1)C(=O)O
Found 4 products.