CymitQuimica logo

CAS 79799-18-1

:

2-Quinolinecarboxylic acid, decahydro-

Description:
2-Quinolinecarboxylic acid, decahydro- is a chemical compound characterized by its bicyclic structure, which includes a quinoline moiety. This compound features a carboxylic acid functional group (-COOH) attached to the quinoline ring system, contributing to its acidic properties. The "decahydro" descriptor indicates that the compound is fully saturated, meaning it has undergone hydrogenation, resulting in a lack of double bonds in the ring structure. This saturation affects its reactivity and stability compared to unsaturated analogs. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its potential applications may include use in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. As with many chemical substances, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards. Always refer to specific safety data sheets and regulatory guidelines for detailed information on handling and usage.
Formula:C10H17NO2
InChI:InChI=1S/C10H17NO2/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9/h7-9,11H,1-6H2,(H,12,13)
InChI key:DIWCUPFNJXAUAE-UHFFFAOYSA-N
SMILES:C1CCC2C(C1)CCC(N2)C(=O)O
Found 5 products.