CAS 798-61-8
:7-O-Methylafromosin
Description:
7-O-Methylafromosin, with the CAS number 798-61-8, is a naturally occurring compound classified as a flavonoid. It is primarily derived from various plant sources, particularly those in the legume family. This compound is characterized by its methoxy group at the 7-position of the flavonoid backbone, which contributes to its unique chemical properties and biological activities. 7-O-Methylafromosin exhibits antioxidant properties, which can help in neutralizing free radicals and reducing oxidative stress in biological systems. Additionally, it has been studied for its potential anti-inflammatory and antimicrobial effects, making it of interest in pharmacological research. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in both research and potential therapeutic uses. Overall, 7-O-Methylafromosin represents a significant area of study within natural product chemistry, particularly for its health-related benefits and applications in traditional medicine.
Formula:C18H16O5
InChI:InChI=1S/C18H16O5/c1-20-12-6-4-11(5-7-12)14-10-23-15-9-17(22-3)16(21-2)8-13(15)18(14)19/h4-10H,1-3H3
InChI key:InChIKey=YHXIOAVHEXKZCQ-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(OC)=C(OC)C2)OC=C1C3=CC=C(OC)C=C3
Synonyms:- 4H-1-Benzopyran-4-one, 6,7-dimethoxy-3-(4-methoxyphenyl)-
- 6,7-Dimethoxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- 6,7-dimethoxy-3-(4-methoxyphenyl)-4H-chromen-4-one
- 7-O-Methylafromosin
- Afromosin 7-O-methyl ether
- Isoflavone, 4′,6,7-trimethoxy-
- Texasin dimethyl ether
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4',6,7-Trimethoxyisoflavone
CAS:Formula:C18H16O5Purity:>97.0%(GC)Color and Shape:White to Light orange to Yellow powder to crystalMolecular weight:312.324',6,7-Trimethoxyisoflavone
CAS:4',6,7-Trimethoxyisoflavone analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C18H16O5Purity:(HPLC) ≥90%Color and Shape:PowderMolecular weight:312.334',6,7-Trimethoxyisoflavone
CAS:Formula:C18H16O5Purity:97%Color and Shape:SolidMolecular weight:312.31664',6,7-Trimethoxyisoflavone
CAS:4',6,7-TrimethoxyisoflavoneFormula:C18H16O5Purity:≥95%Molecular weight:312.324',6,7-Trimethoxyisoflavone
CAS:4',6,7-Trimethoxyisoflavone promotes wound healing through NOX2 induction, which leads to collective migration and MMP activation.Formula:C18H16O5Purity:97.01%Color and Shape:SolidMolecular weight:312.32Ref: TM-TN3016
1mg50.00€1mL*10mM (DMSO)103.00€5mg110.00€10mg164.00€25mg254.00€50mg353.00€100mg480.00€4',6,7-Trimethoxyisoflavone
CAS:4',6,7-Trimethoxyisoflavone is a naturally occurring isoflavone, which is a type of phytoestrogen found in certain plants. This compound is generally derived from plant sources that are rich in isoflavones, such as soybeans and other legumes. Isoflavones like 4',6,7-Trimethoxyisoflavone are known to exhibit a range of biological activities due to their structural similarity to estrogens, allowing them to bind to estrogen receptors.Formula:C18H16O5Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:312.32 g/mol





