CymitQuimica logo

CAS 79917-89-8

:

1-Propyl-3-methylimidazolium chloride

Description:
1-Propyl-3-methylimidazolium chloride is an ionic liquid, specifically a type of room-temperature molten salt, characterized by its low volatility and high thermal stability. It features a cation derived from imidazole, which is a five-membered heterocyclic compound containing nitrogen atoms, and an anion of chloride. This substance is known for its unique properties, including excellent solvation capabilities, making it effective as a solvent for various chemical reactions and processes. It exhibits a relatively low viscosity compared to other ionic liquids, which enhances its applicability in fields such as catalysis, electrochemistry, and materials science. Additionally, 1-propyl-3-methylimidazolium chloride is often studied for its potential in green chemistry due to its ability to dissolve organic and inorganic compounds while minimizing environmental impact. Its hygroscopic nature allows it to absorb moisture from the air, which can affect its stability and performance in certain applications. Overall, this compound is a versatile and valuable material in both research and industrial settings.
Formula:C7H13ClN2
InChI:InChI=1/C7H14N2.ClH/c1-3-4-9-6-5-8(2)7-9;/h5-6H,3-4,7H2,1-2H3;1H
InChI key:InChIKey=JOLFMOZUQSZTML-UHFFFAOYSA-M
SMILES:C(CC)[N+]1=CN(C)C=C1.[Cl-]
Synonyms:
  • 1-Methyl-3-propyl-1H-imidazolium chloride
  • 1-Methyl-3-propyl-2,3-dihydro-1H-imidazol-1-ium chloride
  • 1-Methyl-3-propylimidazolium chloride
  • 1-Propyl-3-methylimidazolium chloride
  • 1H-Imidazolium, 1-methyl-3-propyl-, chloride
  • 1H-Imidazolium, 1-methyl-3-propyl-, chloride (1:1)
  • 3-Methyl-1-propyl-1H-imidazol-3-ium chloride
  • 3-Methyl-1-propylimidazolium chloride
  • PMIMCl
Found 6 products.