CymitQuimica logo

CAS 799283-92-4

:

1-(5-bromopyrimidin-2-yl)piperidine-4-carboxylic acid

Description:
1-(5-Bromopyrimidin-2-yl)piperidine-4-carboxylic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring and a brominated pyrimidine moiety. The presence of the bromine atom at the 5-position of the pyrimidine ring enhances its reactivity and potential for forming various derivatives. This compound features a carboxylic acid functional group at the 4-position of the piperidine ring, which contributes to its acidity and can participate in various chemical reactions, such as esterification or amidation. The molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the compound's solubility and stability can be influenced by the presence of the bromine atom and the carboxylic acid group, affecting its behavior in different solvents and conditions. Overall, 1-(5-bromopyrimidin-2-yl)piperidine-4-carboxylic acid is a versatile compound with applications in research and potential therapeutic uses.
Formula:C10H12BrN3O2
InChI:InChI=1/C10H12BrN3O2/c11-8-5-12-10(13-6-8)14-3-1-7(2-4-14)9(15)16/h5-7H,1-4H2,(H,15,16)
InChI key:NKCDUFJDLOFCEE-UHFFFAOYSA-N
SMILES:C1CN(CCC1C(=O)O)c1ncc(cn1)Br
Synonyms:
  • 4-Piperidinecarboxylic acid, 1-(5-bromo-2-pyrimidinyl)-
  • 1-(5-Bromopyrimidin-2-yl)piperidine-4-carboxylic acid
Found 4 products.