CymitQuimica logo

CAS 799293-85-9

:

Thieno[3,2-c]pyridin-4-amine, 3-bromo-

Description:
Thieno[3,2-c]pyridin-4-amine, 3-bromo- is a heterocyclic organic compound characterized by the presence of a thieno and pyridine ring system. This compound features a bromine atom at the 3-position of the thieno-pyridine structure, which can influence its reactivity and biological activity. The thieno[3,2-c]pyridine framework is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The amine functional group at the 4-position contributes to its basicity and potential for forming hydrogen bonds, which can enhance its solubility and interaction with biological molecules. Additionally, the presence of the bromine substituent can provide opportunities for further chemical modifications, making it a versatile building block in synthetic organic chemistry. Overall, this compound's unique structural features and functional groups make it of interest in both research and industrial applications.
Formula:C7H5BrN2S
InChI:InChI=1S/C7H5BrN2S/c8-4-3-11-5-1-2-10-7(9)6(4)5/h1-3H,(H2,9,10)
InChI key:NRVPVUKWJYSNTO-UHFFFAOYSA-N
SMILES:C1=CN=C(C2=C1SC=C2Br)N
Synonyms:
  • 3-Bromothieno[3,2-c]pyridin-4-amine
Found 4 products.