CymitQuimica logo

CAS 799557-65-6

:

1-cyclobutylpiperazine dihydrochloride

Description:
1-Cyclobutylpiperazine dihydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a cyclobutyl group enhances its structural diversity and may influence its biological activity. As a dihydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, particularly in pharmaceutical formulations. This compound may exhibit properties relevant to neuropharmacology, as piperazine derivatives are often investigated for their potential effects on neurotransmitter systems. Its molecular structure suggests potential interactions with receptors or enzymes, making it a candidate for research in drug development. Safety and handling precautions are essential, as with any chemical substance, and its use should comply with relevant regulations. Overall, 1-cyclobutylpiperazine dihydrochloride represents a unique entity in the realm of organic chemistry, with potential implications in medicinal chemistry and pharmacology.
Formula:C8H18Cl2N2
InChI:InChI=1/C8H16N2.2ClH/c1-2-8(3-1)10-6-4-9-5-7-10;;/h8-9H,1-7H2;2*1H
InChI key:SGDJZAXFNRAMDX-UHFFFAOYSA-N
SMILES:C1CC(C1)N1CCNCC1.Cl.Cl
Synonyms:
  • Piperazine, 1-cyclobutyl-, hydrochloride (1:2)
Found 4 products.