
CAS 799842-06-1
:Methyl 4-(4-Fluorophenyl)-6-isopropyl-2-(methylsulfonyl)pyrimidine- 5-carboxylate
Description:
Methyl 4-(4-Fluorophenyl)-6-isopropyl-2-(methylsulfonyl)pyrimidine-5-carboxylate, identified by CAS number 799842-06-1, is a synthetic organic compound characterized by its pyrimidine core structure, which is substituted with various functional groups. The presence of a methylsulfonyl group enhances its solubility and reactivity, while the isopropyl and fluorophenyl substituents contribute to its lipophilicity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The fluorine atom can influence the compound's electronic properties, potentially enhancing its interaction with biological targets. As with many synthetic compounds, safety and handling precautions are essential, as it may possess toxicological properties that require careful assessment in laboratory settings. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.
Formula:C16H17FN2O4S
InChI:InChI=1S/C16H17FN2O4S/c1-9(2)13-12(15(20)23-3)14(10-5-7-11(17)8-6-10)19-16(18-13)24(4,21)22/h5-9H,1-4H3
InChI key:YEMPJZCYHYWHGT-UHFFFAOYSA-N
SMILES:CC(C)C1=NC(=NC(=C1C(=O)OC)C2=CC=C(C=C2)F)S(=O)(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
METHYL 4-(4-FLUOROPHENYL)-6-ISOPROPYL-2-(METHYLSULFONYL)PYRIMIDINE-5-CARBOXYLATE
CAS:Formula:C16H17FN2O4SColor and Shape:SolidMolecular weight:352.3806Methyl 4-(4-Fluorophenyl)-6-isopropyl-2-methylsulfonylpyrimidine-5-carboxylate
CAS:Color and Shape:NeatMethyl 4-(4-Fluorophenyl)-6-isopropyl-2-(methylsulfonyl)pyrimidine-5-carboxylate
CAS:Controlled ProductApplications An intermediate of Rosuvastatin (R700500).
References Laufer, S., et al.: J. Med. Chem., 45, 2733 (2002), Palani, A., et al.: Bioorg. Med. Chem. Lett., 13, 709 (2003),Formula:C16H17FN2O4SColor and Shape:NeatMolecular weight:352.38




